C41H32N3Pt+ — CID 171732606
1-(3-tert-butylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;9-phenyl-1H-carbazol-1-ide;platinum(4+) (PubChem CID 171732606) has the molecular formula C41H32N3Pt+ and a molecular weight of 761.81 g/mol. Its IUPAC name is 1-(3-tert-butylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;9-phenyl-1H-carbazol-1-ide;platinum(4+).
| Compound Name | 1-(3-tert-butylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;9-phenyl-1H-carbazol-1-ide;platinum(4+) |
|---|---|
| PubChem CID | 171732606 |
| Molecular Formula | C41H32N3Pt+ |
| Molecular Weight | 761.81 g/mol |
| Exact Mass | 761.22 |
| IUPAC Name | 1-(3-tert-butylphenyl)-3-phenyl-2H-benzimidazol-1-ium-2-ide;9-phenyl-1H-carbazol-1-ide;platinum(4+) |
| SMILES | CC(C)(C)c1cccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)c1.[Pt+4].[c-]1ccccc1-n1c2[c-]cccc2c2ccccc21 |
| InChI | InChI=1S/C23H21N2.C18H11N.Pt/c1-23(2,3)18-10-9-13-20(16-18)25-17-24(19-11-5-4-6-12-19)21-14-7-8-15-22(21)25;1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h4-11,13-16H,1-3H3;1-8,10-12H;/q-1;-2;+4 |
| InChIKey | NASFBVREWVYGEG-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.81 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|