C44H29BN3OPt+ — CID 171732630
CID 171732630 (PubChem CID 171732630) has the molecular formula C44H29BN3OPt+ and a molecular weight of 821.63 g/mol.
| Compound Name | CID 171732630 |
|---|---|
| PubChem CID | 171732630 |
| Molecular Formula | C44H29BN3OPt+ |
| Molecular Weight | 821.63 g/mol |
| Exact Mass | 821.20 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-[n+]2[c-]n(-c3[c-]cccc3)c3ccccc32)cc1.[Pt+4].[c-]1cccc2c1B1c3[c-]cccc3N(c3ccccc3)c3cccc(c31)O2 |
| InChI | InChI=1S/C24H14BNO.C20H15N2.Pt/c1-2-9-17(10-3-1)26-20-13-6-4-11-18(20)25-19-12-5-7-15-22(19)27-23-16-8-14-21(26)24(23)25;1-16-11-13-18(14-12-16)22-15-21(17-7-3-2-4-8-17)19-9-5-6-10-20(19)22;/h1-10,13-16H;2-7,9-14H,1H3;/q-2;-1;+4 |
| InChIKey | YPZFOSYDUMTZRR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|