C40H35BIrN5 — CID 164734072
CID 164734072 (PubChem CID 164734072) has the molecular formula C40H35BIrN5 and a molecular weight of 788.78 g/mol.
| Compound Name | CID 164734072 |
|---|---|
| PubChem CID | 164734072 |
| Molecular Formula | C40H35BIrN5 |
| Molecular Weight | 788.78 g/mol |
| Exact Mass | 789.26 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2N2[CH-]N(c3[c-]cccc3)c3cccc1c32.Cc1cccc(C)c1B1N(C)c2ccc[c-]c2-c2nccn21.[Ir+3] |
| InChI | InChI=1S/C22H18N2.C18H17BN3.Ir/c1-22(2)17-11-6-7-13-19(17)24-15-23(16-9-4-3-5-10-16)20-14-8-12-18(22)21(20)24;1-13-7-6-8-14(2)17(13)19-21(3)16-10-5-4-9-15(16)18-20-11-12-22(18)19;/h3-9,11-15H,1-2H3;4-8,10-12H,1-3H3;/q-2;-1;+3 |
| InChIKey | FCPWLFUEZZOEMR-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.78 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|