C49H42BIrN5+ — CID 168782413
CID 168782413 (PubChem CID 168782413) has the molecular formula C49H42BIrN5+ and a molecular weight of 903.94 g/mol.
| Compound Name | CID 168782413 |
|---|---|
| PubChem CID | 168782413 |
| Molecular Formula | C49H42BIrN5+ |
| Molecular Weight | 903.94 g/mol |
| Exact Mass | 904.32 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1B1N(C)c2ccc[c-]c2-c2nccn21.[Ir+3].[c-]1ccccc1-n1[c-][n+]2c(c1)-c1ccccc1-c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C27H17N2.C22H25BN3.Ir/c1-2-10-20(11-3-1)28-18-27-25-16-7-6-14-23(25)21-12-4-5-13-22(21)24-15-8-9-17-26(24)29(27)19-28;1-15(2)17-10-8-11-18(16(3)4)21(17)23-25(5)20-12-7-6-9-19(20)22-24-13-14-26(22)23;/h1-10,12-18H;6-8,10-16H,1-5H3;/q2*-1;+3 |
| InChIKey | IGOFIANPYKGPFY-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 29.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.94 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|