C34H22N4Pt — CID 168836195
CID 168836195 (PubChem CID 168836195) has the molecular formula C34H22N4Pt and a molecular weight of 681.66 g/mol.
| Compound Name | CID 168836195 |
|---|---|
| PubChem CID | 168836195 |
| Molecular Formula | C34H22N4Pt |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.15 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c2cccc1N(c1ccccc1-c1ccccc1)c1[c-]c(ccc1)-c1cccc(n1)Nc1cccc-2n1 |
| InChI | InChI=1S/C34H22N4.Pt/c1-2-10-24(11-3-1)29-16-4-5-19-32(29)38-27-14-6-12-25(22-27)30-17-8-20-33(35-30)37-34-21-9-18-31(36-34)26-13-7-15-28(38)23-26;/h1-21H,(H,35,36,37);/q-2;+2 |
| InChIKey | BWVXVHNUIWYJKN-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|