C14H9N3O2 — CID 125269943
4-(2-phenylphenyl)-1,2,4-triazole-3,5-dione (PubChem CID 125269943) has the molecular formula C14H9N3O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 4-(2-phenylphenyl)-1,2,4-triazole-3,5-dione.
| Compound Name | 4-(2-phenylphenyl)-1,2,4-triazole-3,5-dione |
|---|---|
| PubChem CID | 125269943 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-(2-phenylphenyl)-1,2,4-triazole-3,5-dione |
| SMILES | O=C1N=NC(=O)N1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C14H9N3O2/c18-13-15-16-14(19)17(13)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | STHXHBJQHYNGOI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |