C62H38N8O2 — CID 134234979
4-[1,8-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (PubChem CID 134234979) has the molecular formula C62H38N8O2 and a molecular weight of 927.04 g/mol. Its IUPAC name is 4-[1,8-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[1,8-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234979 |
| Molecular Formula | C62H38N8O2 |
| Molecular Weight | 927.04 g/mol |
| Exact Mass | 926.31 |
| IUPAC Name | 4-[1,8-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cccc4c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c43)c2C(=O)N1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C62H38N8O2/c71-61-47-34-20-38-51(52(47)62(72)70(61)50-37-17-16-31-44(50)39-21-6-1-7-22-39)69-53-45(32-18-35-48(53)59-65-55(40-23-8-2-9-24-40)63-56(66-59)41-25-10-3-11-26-41)46-33-19-36-49(54(46)69)60-67-57(42-27-12-4-13-28-42)64-58(68-60)43-29-14-5-15-30-43/h1-38H |
| InChIKey | IAUGKTAKBWLIMB-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 119.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.04 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|