C46H28N6O2 — CID 134241105
2-(2,6-diphenylphenyl)-4-[1,8-di(pyrimidin-5-yl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 134241105) has the molecular formula C46H28N6O2 and a molecular weight of 696.77 g/mol. Its IUPAC name is 2-(2,6-diphenylphenyl)-4-[1,8-di(pyrimidin-5-yl)carbazol-9-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-diphenylphenyl)-4-[1,8-di(pyrimidin-5-yl)carbazol-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134241105 |
| Molecular Formula | C46H28N6O2 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | 2-(2,6-diphenylphenyl)-4-[1,8-di(pyrimidin-5-yl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4c(-c5cncnc5)cccc4c4cccc(-c5cncnc5)c43)c2C(=O)N1c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C46H28N6O2/c53-45-39-21-10-22-40(41(39)46(54)52(45)42-33(29-11-3-1-4-12-29)15-7-16-34(42)30-13-5-2-6-14-30)51-43-35(31-23-47-27-48-24-31)17-8-19-37(43)38-20-9-18-36(44(38)51)32-25-49-28-50-26-32/h1-28H |
| InChIKey | AHPWHWUGAJDBLU-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 93.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|