C52H44N2O2 — CID 142280870
4-(1,8-ditert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione (PubChem CID 142280870) has the molecular formula C52H44N2O2 and a molecular weight of 728.94 g/mol. Its IUPAC name is 4-(1,8-ditert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-(1,8-ditert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142280870 |
| Molecular Formula | C52H44N2O2 |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.34 |
| IUPAC Name | 4-(1,8-ditert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1cccc2c3cccc(C(C)(C)C)c3n(-c3cccc4c3C(=O)N(c3c(-c5ccccc5)cc(-c5ccccc5)cc3-c3ccccc3)C4=O)c12 |
| InChI | InChI=1S/C52H44N2O2/c1-51(2,3)42-28-16-25-37-38-26-17-29-43(52(4,5)6)48(38)53(47(37)42)44-30-18-27-39-45(44)50(56)54(49(39)55)46-40(34-21-12-8-13-22-34)31-36(33-19-10-7-11-20-33)32-41(46)35-23-14-9-15-24-35/h7-32H,1-6H3 |
| InChIKey | WFQJNRROIIDAJG-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|