C48H36N2O2 — CID 142280815
4-(3-tert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione (PubChem CID 142280815) has the molecular formula C48H36N2O2 and a molecular weight of 672.83 g/mol. Its IUPAC name is 4-(3-tert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-(3-tert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142280815 |
| Molecular Formula | C48H36N2O2 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 4-(3-tert-butylcarbazol-9-yl)-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1cccc2c1C(=O)N(c1c(-c3ccccc3)cc(-c3ccccc3)cc1-c1ccccc1)C2=O |
| InChI | InChI=1S/C48H36N2O2/c1-48(2,3)35-26-27-42-40(30-35)36-22-13-14-24-41(36)49(42)43-25-15-23-37-44(43)47(52)50(46(37)51)45-38(32-18-9-5-10-19-32)28-34(31-16-7-4-8-17-31)29-39(45)33-20-11-6-12-21-33/h4-30H,1-3H3 |
| InChIKey | TWYLEKUYWPHFEH-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|