C42H32N2O2 — CID 134233934
4-(3-tert-butylcarbazol-9-yl)-2-(2,6-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134233934) has the molecular formula C42H32N2O2 and a molecular weight of 596.73 g/mol. Its IUPAC name is 4-(3-tert-butylcarbazol-9-yl)-2-(2,6-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-(3-tert-butylcarbazol-9-yl)-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134233934 |
| Molecular Formula | C42H32N2O2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 4-(3-tert-butylcarbazol-9-yl)-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1cccc2c1C(=O)N(c1c(-c3ccccc3)cccc1-c1ccccc1)C2=O |
| InChI | InChI=1S/C42H32N2O2/c1-42(2,3)29-24-25-36-34(26-29)32-18-10-11-22-35(32)43(36)37-23-13-21-33-38(37)41(46)44(40(33)45)39-30(27-14-6-4-7-15-27)19-12-20-31(39)28-16-8-5-9-17-28/h4-26H,1-3H3 |
| InChIKey | UJTLAIIPMLXDLJ-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|