C46H32N2O2 — CID 134234405
4-[1-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134234405) has the molecular formula C46H32N2O2 and a molecular weight of 644.77 g/mol. Its IUPAC name is 4-[1-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[1-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234405 |
| Molecular Formula | C46H32N2O2 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | 4-[1-(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2cccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4c(-c6ccccc6)cccc4-c4ccccc4)C5=O)c23)c(C)c1 |
| InChI | InChI=1S/C46H32N2O2/c1-29-26-27-33(30(2)28-29)37-21-12-22-38-36-18-9-10-24-40(36)47(44(37)38)41-25-13-23-39-42(41)46(50)48(45(39)49)43-34(31-14-5-3-6-15-31)19-11-20-35(43)32-16-7-4-8-17-32/h3-28H,1-2H3 |
| InChIKey | DITYVUOBFAGXCQ-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|