C54H34N4O4 — CID 118972459
4-carbazol-9-yl-2-[4-[4-(4-carbazol-9-yl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]isoindole-1,3-dione (PubChem CID 118972459) has the molecular formula C54H34N4O4 and a molecular weight of 802.89 g/mol. Its IUPAC name is 4-carbazol-9-yl-2-[4-[4-(4-carbazol-9-yl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]isoindole-1,3-dione.
| Compound Name | 4-carbazol-9-yl-2-[4-[4-(4-carbazol-9-yl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118972459 |
| Molecular Formula | C54H34N4O4 |
| Molecular Weight | 802.89 g/mol |
| Exact Mass | 802.26 |
| IUPAC Name | 4-carbazol-9-yl-2-[4-[4-(4-carbazol-9-yl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3cccc(-n4c5ccccc5c5ccccc54)c3C2=O)ccc1-c1ccc(N2C(=O)c3cccc(-n4c5ccccc5c5ccccc54)c3C2=O)cc1C |
| InChI | InChI=1S/C54H34N4O4/c1-31-29-33(55-51(59)41-17-11-23-47(49(41)53(55)61)57-43-19-7-3-13-37(43)38-14-4-8-20-44(38)57)25-27-35(31)36-28-26-34(30-32(36)2)56-52(60)42-18-12-24-48(50(42)54(56)62)58-45-21-9-5-15-39(45)40-16-6-10-22-46(40)58/h3-30H,1-2H3 |
| InChIKey | MCTVGIICDZRVBF-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.89 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|