C39H26N2O2 — CID 134234241
4-[2-(3-methylphenyl)carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione (PubChem CID 134234241) has the molecular formula C39H26N2O2 and a molecular weight of 554.65 g/mol. Its IUPAC name is 4-[2-(3-methylphenyl)carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2-(3-methylphenyl)carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234241 |
| Molecular Formula | C39H26N2O2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 4-[2-(3-methylphenyl)carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cccc(-c2ccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4cccc(-c6ccccc6)c4)C5=O)c3c2)c1 |
| InChI | InChI=1S/C39H26N2O2/c1-25-10-7-13-27(22-25)29-20-21-32-31-16-5-6-18-34(31)41(36(32)24-29)35-19-9-17-33-37(35)39(43)40(38(33)42)30-15-8-14-28(23-30)26-11-3-2-4-12-26/h2-24H,1H3 |
| InChIKey | KAHZAWHWJWEFCH-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|