C45H30N2O2 — CID 134233958
2-(3,5-diphenylphenyl)-4-[2-(4-methylphenyl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 134233958) has the molecular formula C45H30N2O2 and a molecular weight of 630.75 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[2-(4-methylphenyl)carbazol-9-yl]isoindole-1,3-dione.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[2-(4-methylphenyl)carbazol-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134233958 |
| Molecular Formula | C45H30N2O2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[2-(4-methylphenyl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4cc(-c6ccccc6)cc(-c6ccccc6)c4)C5=O)c3c2)cc1 |
| InChI | InChI=1S/C45H30N2O2/c1-29-19-21-32(22-20-29)33-23-24-38-37-15-8-9-17-40(37)47(42(38)28-33)41-18-10-16-39-43(41)45(49)46(44(39)48)36-26-34(30-11-4-2-5-12-30)25-35(27-36)31-13-6-3-7-14-31/h2-28H,1H3 |
| InChIKey | PNXMEIUVOSAOCM-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|