C40H25F3N2O2 — CID 157418592
4-[2-[4-methyl-2-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione (PubChem CID 157418592) has the molecular formula C40H25F3N2O2 and a molecular weight of 622.65 g/mol. Its IUPAC name is 4-[2-[4-methyl-2-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2-[4-methyl-2-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157418592 |
| Molecular Formula | C40H25F3N2O2 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | 4-[2-[4-methyl-2-(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4cccc(-c6ccccc6)c4)C5=O)c3c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C40H25F3N2O2/c1-24-17-19-29(33(21-24)40(41,42)43)27-18-20-31-30-13-5-6-15-34(30)45(36(31)23-27)35-16-8-14-32-37(35)39(47)44(38(32)46)28-12-7-11-26(22-28)25-9-3-2-4-10-25/h2-23H,1H3 |
| InChIKey | KLOMGELUCBDXIQ-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|