C70H42N4O4 — CID 118972399
4-(3,6-diphenylcarbazol-9-yl)-2-[4-[4-(3,6-diphenylcarbazol-9-yl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 118972399) has the molecular formula C70H42N4O4 and a molecular weight of 1003.13 g/mol. Its IUPAC name is 4-(3,6-diphenylcarbazol-9-yl)-2-[4-[4-(3,6-diphenylcarbazol-9-yl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 4-(3,6-diphenylcarbazol-9-yl)-2-[4-[4-(3,6-diphenylcarbazol-9-yl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118972399 |
| Molecular Formula | C70H42N4O4 |
| Molecular Weight | 1003.13 g/mol |
| Exact Mass | 1002.32 |
| IUPAC Name | 4-(3,6-diphenylcarbazol-9-yl)-2-[4-[4-(3,6-diphenylcarbazol-9-yl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)c2C(=O)N1c1ccc(N2C(=O)c3cccc(-n4c5ccc(-c6ccccc6)cc5c5cc(-c6ccccc6)ccc54)c3C2=O)cc1 |
| InChI | InChI=1S/C70H42N4O4/c75-67-53-23-13-25-63(73-59-35-27-47(43-15-5-1-6-16-43)39-55(59)56-40-48(28-36-60(56)73)44-17-7-2-8-18-44)65(53)69(77)71(67)51-31-33-52(34-32-51)72-68(76)54-24-14-26-64(66(54)70(72)78)74-61-37-29-49(45-19-9-3-10-20-45)41-57(61)58-42-50(30-38-62(58)74)46-21-11-4-12-22-46/h1-42H |
| InChIKey | CNTZCWYOOBEDHN-UHFFFAOYSA-N |
| XLogP | 16.15 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.13 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|