C40H24N6O2 — CID 134240974
4-[3,6-di(pyrimidin-5-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (PubChem CID 134240974) has the molecular formula C40H24N6O2 and a molecular weight of 620.67 g/mol. Its IUPAC name is 4-[3,6-di(pyrimidin-5-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[3,6-di(pyrimidin-5-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134240974 |
| Molecular Formula | C40H24N6O2 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 4-[3,6-di(pyrimidin-5-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccc(-c5cncnc5)cc4c4cc(-c5cncnc5)ccc43)c2C(=O)N1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C40H24N6O2/c47-39-31-10-6-12-37(38(31)40(48)46(39)34-11-5-4-9-30(34)25-7-2-1-3-8-25)45-35-15-13-26(28-19-41-23-42-20-28)17-32(35)33-18-27(14-16-36(33)45)29-21-43-24-44-22-29/h1-24H |
| InChIKey | GTVKUKKXXZGONL-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 93.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|