C53H33N5O2 — CID 134235066
2-(2,4-diphenylphenyl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 134235066) has the molecular formula C53H33N5O2 and a molecular weight of 771.88 g/mol. Its IUPAC name is 2-(2,4-diphenylphenyl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-diphenylphenyl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134235066 |
| Molecular Formula | C53H33N5O2 |
| Molecular Weight | 771.88 g/mol |
| Exact Mass | 771.26 |
| IUPAC Name | 2-(2,4-diphenylphenyl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccccc4c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc43)c2C(=O)N1c1ccc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C53H33N5O2/c59-52-41-25-15-27-47(48(41)53(60)58(52)45-30-28-38(34-16-5-1-6-17-34)32-42(45)35-18-7-2-8-19-35)57-44-26-14-13-24-40(44)43-33-39(29-31-46(43)57)51-55-49(36-20-9-3-10-21-36)54-50(56-51)37-22-11-4-12-23-37/h1-33H |
| InChIKey | JFVNHLJBNZFCHK-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.88 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|