C45H27N3O2 — CID 158329082
2-(2,4-diphenylphenyl)-4-[2-(4-isocyanophenyl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 158329082) has the molecular formula C45H27N3O2 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-(2,4-diphenylphenyl)-4-[2-(4-isocyanophenyl)carbazol-9-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-diphenylphenyl)-4-[2-(4-isocyanophenyl)carbazol-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158329082 |
| Molecular Formula | C45H27N3O2 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 2-(2,4-diphenylphenyl)-4-[2-(4-isocyanophenyl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4ccc(-c6ccccc6)cc4-c4ccccc4)C5=O)c3c2)cc1 |
| InChI | InChI=1S/C45H27N3O2/c1-46-34-23-19-30(20-24-34)33-21-25-36-35-15-8-9-17-39(35)47(42(36)28-33)41-18-10-16-37-43(41)45(50)48(44(37)49)40-26-22-32(29-11-4-2-5-12-29)27-38(40)31-13-6-3-7-14-31/h2-28H |
| InChIKey | XMNJTWIIABFODK-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|