C46H26N4O2 — CID 161410544
4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione (PubChem CID 161410544) has the molecular formula C46H26N4O2 and a molecular weight of 666.74 g/mol. Its IUPAC name is 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161410544 |
| Molecular Formula | C46H26N4O2 |
| Molecular Weight | 666.74 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 4-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2cccc3c2C(=O)N(c2cc(-c4ccccc4)ccc2-c2ccccc2)C3=O)c([N+]#[C-])c1 |
| InChI | InChI=1S/C46H26N4O2/c1-47-33-22-24-34(39(28-33)48-2)32-21-25-41-38(26-32)36-16-9-10-18-40(36)49(41)42-19-11-17-37-44(42)46(52)50(45(37)51)43-27-31(29-12-5-3-6-13-29)20-23-35(43)30-14-7-4-8-15-30/h3-28H |
| InChIKey | MYEFHBOVGBRJIZ-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.74 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|