C49H40N2O2 — CID 142280707
2-(2,5-diphenylphenyl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]isoindole-1,3-dione;ethane (PubChem CID 142280707) has the molecular formula C49H40N2O2 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]isoindole-1,3-dione;ethane.
| Compound Name | 2-(2,5-diphenylphenyl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 142280707 |
| Molecular Formula | C49H40N2O2 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]isoindole-1,3-dione;ethane |
| SMILES | CC.Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2cccc3c2C(=O)N(c2cc(-c4ccccc4)ccc2-c2ccccc2)C3=O)c(C)c1 |
| InChI | InChI=1S/C47H34N2O2.C2H6/c1-29-25-30(2)44(31(3)26-29)35-22-24-41-39(27-35)37-17-10-11-19-40(37)48(41)42-20-12-18-38-45(42)47(51)49(46(38)50)43-28-34(32-13-6-4-7-14-32)21-23-36(43)33-15-8-5-9-16-33;1-2/h4-28H,1-3H3;1-2H3 |
| InChIKey | HHLFENOZLYCQSB-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|