C37H25N5O2 — CID 134234566
4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (PubChem CID 134234566) has the molecular formula C37H25N5O2 and a molecular weight of 571.64 g/mol. Its IUPAC name is 4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134234566 |
| Molecular Formula | C37H25N5O2 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2cccc3c2C(=O)N(c2ccccc2-c2ccccc2)C3=O)n1 |
| InChI | InChI=1S/C37H25N5O2/c1-22-38-23(2)40-35(39-22)25-19-20-32-29(21-25)27-14-7-9-17-31(27)41(32)33-18-10-15-28-34(33)37(44)42(36(28)43)30-16-8-6-13-26(30)24-11-4-3-5-12-24/h3-21H,1-2H3 |
| InChIKey | FJSUKAXYIVKPBB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|