C42H30N8O2 — CID 142280807
4-[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione (PubChem CID 142280807) has the molecular formula C42H30N8O2 and a molecular weight of 678.76 g/mol. Its IUPAC name is 4-[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142280807 |
| Molecular Formula | C42H30N8O2 |
| Molecular Weight | 678.76 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 4-[2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(2-phenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccc(-c5nc(C)nc(C)n5)cc4n(-c4cccc5c4C(=O)N(c4ccccc4-c4ccccc4)C5=O)c3c2)n1 |
| InChI | InChI=1S/C42H30N8O2/c1-23-43-24(2)46-39(45-23)28-17-19-31-32-20-18-29(40-47-25(3)44-26(4)48-40)22-37(32)49(36(31)21-28)35-16-10-14-33-38(35)42(52)50(41(33)51)34-15-9-8-13-30(34)27-11-6-5-7-12-27/h5-22H,1-4H3 |
| InChIKey | LXARTLFSALUEFO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 119.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.76 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|