C40H22N4O2 — CID 134240962
5-[9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 134240962) has the molecular formula C40H22N4O2 and a molecular weight of 590.64 g/mol. Its IUPAC name is 5-[9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 134240962 |
| Molecular Formula | C40H22N4O2 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 5-[9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4ccccc4-c4ccccc4)C5=O)c3c2)c1 |
| InChI | InChI=1S/C40H22N4O2/c41-23-25-19-26(24-42)21-29(20-25)28-17-18-32-31-12-5-7-15-35(31)43(37(32)22-28)36-16-8-13-33-38(36)40(46)44(39(33)45)34-14-6-4-11-30(34)27-9-2-1-3-10-27/h1-22H |
| InChIKey | KXJJEUGJWGIWKF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|