C52H30N4O2 — CID 134241214
3-[7-(3-cyanophenyl)-9-[2-(2,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-2-yl]benzonitrile (PubChem CID 134241214) has the molecular formula C52H30N4O2 and a molecular weight of 742.84 g/mol. Its IUPAC name is 3-[7-(3-cyanophenyl)-9-[2-(2,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-2-yl]benzonitrile.
| Compound Name | 3-[7-(3-cyanophenyl)-9-[2-(2,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 134241214 |
| Molecular Formula | C52H30N4O2 |
| Molecular Weight | 742.84 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | 3-[7-(3-cyanophenyl)-9-[2-(2,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c4ccc(-c5cccc(C#N)c5)cc4n(-c4cccc5c4C(=O)N(c4cc(-c6ccccc6)ccc4-c4ccccc4)C5=O)c3c2)c1 |
| InChI | InChI=1S/C52H30N4O2/c53-31-33-10-7-16-37(26-33)40-21-24-43-44-25-22-41(38-17-8-11-34(27-38)32-54)30-49(44)55(48(43)29-40)46-19-9-18-45-50(46)52(58)56(51(45)57)47-28-39(35-12-3-1-4-13-35)20-23-42(47)36-14-5-2-6-15-36/h1-30H |
| InChIKey | DBFPJUAWPPCJFN-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.84 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|