C48H30N4O2 — CID 134241101
2-(2,5-diphenylphenyl)-4-(2,7-dipyridin-4-ylcarbazol-9-yl)isoindole-1,3-dione (PubChem CID 134241101) has the molecular formula C48H30N4O2 and a molecular weight of 694.79 g/mol. Its IUPAC name is 2-(2,5-diphenylphenyl)-4-(2,7-dipyridin-4-ylcarbazol-9-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,5-diphenylphenyl)-4-(2,7-dipyridin-4-ylcarbazol-9-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134241101 |
| Molecular Formula | C48H30N4O2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | 2-(2,5-diphenylphenyl)-4-(2,7-dipyridin-4-ylcarbazol-9-yl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4cc(-c5ccncc5)ccc4c4ccc(-c5ccncc5)cc43)c2C(=O)N1c1cc(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C48H30N4O2/c53-47-41-12-7-13-42(46(41)48(54)52(47)43-28-35(31-8-3-1-4-9-31)14-17-38(43)34-10-5-2-6-11-34)51-44-29-36(32-20-24-49-25-21-32)15-18-39(44)40-19-16-37(30-45(40)51)33-22-26-50-27-23-33/h1-30H |
| InChIKey | JPVKVIULXLFSFG-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|