C47H30N4O2 — CID 142280776
acetonitrile;3-[9-[2-(2,4-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile (PubChem CID 142280776) has the molecular formula C47H30N4O2 and a molecular weight of 682.78 g/mol. Its IUPAC name is acetonitrile;3-[9-[2-(2,4-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile.
| Compound Name | acetonitrile;3-[9-[2-(2,4-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 142280776 |
| Molecular Formula | C47H30N4O2 |
| Molecular Weight | 682.78 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | acetonitrile;3-[9-[2-(2,4-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile |
| SMILES | CC#N.N#Cc1cccc(-c2cccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4ccc(-c6ccccc6)cc4-c4ccccc4)C5=O)c23)c1 |
| InChI | InChI=1S/C45H27N3O2.C2H3N/c46-28-29-12-9-17-33(26-29)34-19-10-20-36-35-18-7-8-22-39(35)47(43(34)36)41-23-11-21-37-42(41)45(50)48(44(37)49)40-25-24-32(30-13-3-1-4-14-30)27-38(40)31-15-5-2-6-16-31;1-2-3/h1-27H;1H3 |
| InChIKey | YIJCCAHCFGRIHY-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.78 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|