C56H42N4O2 — CID 142280762
4-[8-(4-cyanophenyl)-9-[2-(3,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile;ethane (PubChem CID 142280762) has the molecular formula C56H42N4O2 and a molecular weight of 802.98 g/mol. Its IUPAC name is 4-[8-(4-cyanophenyl)-9-[2-(3,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile;ethane.
| Compound Name | 4-[8-(4-cyanophenyl)-9-[2-(3,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile;ethane |
|---|---|
| PubChem CID | 142280762 |
| Molecular Formula | C56H42N4O2 |
| Molecular Weight | 802.98 g/mol |
| Exact Mass | 802.33 |
| IUPAC Name | 4-[8-(4-cyanophenyl)-9-[2-(3,5-diphenylphenyl)-1,3-dioxoisoindol-4-yl]carbazol-1-yl]benzonitrile;ethane |
| SMILES | CC.CC.N#Cc1ccc(-c2cccc3c4cccc(-c5ccc(C#N)cc5)c4n(-c4cccc5c4C(=O)N(c4cc(-c6ccccc6)cc(-c6ccccc6)c4)C5=O)c23)cc1 |
| InChI | InChI=1S/C52H30N4O2.2C2H6/c53-31-33-20-24-37(25-21-33)42-14-7-16-44-45-17-8-15-43(38-26-22-34(32-54)23-27-38)50(45)56(49(42)44)47-19-9-18-46-48(47)52(58)55(51(46)57)41-29-39(35-10-3-1-4-11-35)28-40(30-41)36-12-5-2-6-13-36;2*1-2/h1-30H;2*1-2H3 |
| InChIKey | MKNCUBJXLRQKFC-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.98 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|