C43H29N5O2 — CID 134235007
4-[1-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione (PubChem CID 134235007) has the molecular formula C43H29N5O2 and a molecular weight of 647.74 g/mol. Its IUPAC name is 4-[1-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[1-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134235007 |
| Molecular Formula | C43H29N5O2 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 4-[1-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-(3,5-diphenylphenyl)isoindole-1,3-dione |
| SMILES | Cc1nc(C)nc(-c2cccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4cc(-c6ccccc6)cc(-c6ccccc6)c4)C5=O)c23)n1 |
| InChI | InChI=1S/C43H29N5O2/c1-26-44-27(2)46-41(45-26)36-20-11-18-34-33-17-9-10-21-37(33)48(40(34)36)38-22-12-19-35-39(38)43(50)47(42(35)49)32-24-30(28-13-5-3-6-14-28)23-31(25-32)29-15-7-4-8-16-29/h3-25H,1-2H3 |
| InChIKey | HJQURBHVEGWUER-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|