C37H27N5O2 — CID 142280546
methanamine;2-(4-phenylphenyl)-4-(1-pyrimidin-5-ylcarbazol-9-yl)isoindole-1,3-dione (PubChem CID 142280546) has the molecular formula C37H27N5O2 and a molecular weight of 573.66 g/mol. Its IUPAC name is methanamine;2-(4-phenylphenyl)-4-(1-pyrimidin-5-ylcarbazol-9-yl)isoindole-1,3-dione.
| Compound Name | methanamine;2-(4-phenylphenyl)-4-(1-pyrimidin-5-ylcarbazol-9-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142280546 |
| Molecular Formula | C37H27N5O2 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | methanamine;2-(4-phenylphenyl)-4-(1-pyrimidin-5-ylcarbazol-9-yl)isoindole-1,3-dione |
| SMILES | CN.O=C1c2cccc(-n3c4ccccc4c4cccc(-c5cncnc5)c43)c2C(=O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H22N4O2.CH5N/c41-35-30-13-7-15-32(33(30)36(42)39(35)26-18-16-24(17-19-26)23-8-2-1-3-9-23)40-31-14-5-4-10-28(31)29-12-6-11-27(34(29)40)25-20-37-22-38-21-25;1-2/h1-22H;2H2,1H3 |
| InChIKey | XNSRJSPHMCQDEW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|