C50H30F12N2O2 — CID 142280857
4-[1,8-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione;ethane (PubChem CID 142280857) has the molecular formula C50H30F12N2O2 and a molecular weight of 918.78 g/mol. Its IUPAC name is 4-[1,8-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione;ethane.
| Compound Name | 4-[1,8-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 142280857 |
| Molecular Formula | C50H30F12N2O2 |
| Molecular Weight | 918.78 g/mol |
| Exact Mass | 918.21 |
| IUPAC Name | 4-[1,8-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3-phenylphenyl)isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1c2cccc(-n3c4c(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cccc4c4cccc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)c43)c2C(=O)N1c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C48H24F12N2O2.C2H6/c49-45(50,51)29-18-27(19-30(23-29)46(52,53)54)34-12-5-14-36-37-15-6-13-35(28-20-31(47(55,56)57)24-32(21-28)48(58,59)60)42(37)62(41(34)36)39-17-7-16-38-40(39)44(64)61(43(38)63)33-11-4-10-26(22-33)25-8-2-1-3-9-25;1-2/h1-24H;1-2H3 |
| InChIKey | KVWZMRMYFPNGGC-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.78 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|