C48H24N6O2 — CID 157139884
3-[8-(3-cyano-5-isocyanophenyl)-9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-1-yl]-5-isocyanobenzonitrile (PubChem CID 157139884) has the molecular formula C48H24N6O2 and a molecular weight of 716.76 g/mol. Its IUPAC name is 3-[8-(3-cyano-5-isocyanophenyl)-9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-1-yl]-5-isocyanobenzonitrile.
| Compound Name | 3-[8-(3-cyano-5-isocyanophenyl)-9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-1-yl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 157139884 |
| Molecular Formula | C48H24N6O2 |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.20 |
| IUPAC Name | 3-[8-(3-cyano-5-isocyanophenyl)-9-[1,3-dioxo-2-(2-phenylphenyl)isoindol-4-yl]carbazol-1-yl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2cccc3c4cccc(-c5cc(C#N)cc([N+]#[C-])c5)c4n(-c4cccc5c4C(=O)N(c4ccccc4-c4ccccc4)C5=O)c23)c1 |
| InChI | InChI=1S/C48H24N6O2/c1-51-34-23-29(27-49)21-32(25-34)37-14-8-16-39-40-17-9-15-38(33-22-30(28-50)24-35(26-33)52-2)46(40)53(45(37)39)43-20-10-18-41-44(43)48(56)54(47(41)55)42-19-7-6-13-36(42)31-11-4-3-5-12-31/h3-26H |
| InChIKey | FIXKDNKTHGLLBK-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|