C52H30N4O2 — CID 162446203
4-[1,8-bis(3-isocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione (PubChem CID 162446203) has the molecular formula C52H30N4O2 and a molecular weight of 742.84 g/mol. Its IUPAC name is 4-[1,8-bis(3-isocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[1,8-bis(3-isocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162446203 |
| Molecular Formula | C52H30N4O2 |
| Molecular Weight | 742.84 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | 4-[1,8-bis(3-isocyanophenyl)carbazol-9-yl]-2-(2,5-diphenylphenyl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1cccc(-c2cccc3c4cccc(-c5cccc([N+]#[C-])c5)c4n(-c4cccc5c4C(=O)N(c4cc(-c6ccccc6)ccc4-c4ccccc4)C5=O)c23)c1 |
| InChI | InChI=1S/C52H30N4O2/c1-53-38-20-9-18-36(30-38)41-22-11-24-43-44-25-12-23-42(37-19-10-21-39(31-37)54-2)50(44)55(49(41)43)46-27-13-26-45-48(46)52(58)56(51(45)57)47-32-35(33-14-5-3-6-15-33)28-29-40(47)34-16-7-4-8-17-34/h3-32H |
| InChIKey | ZVPVVFKQDIJPHJ-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.84 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|