C51H31N3O2 — CID 158897469
4-[1-(4-isocyanophenyl)carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione (PubChem CID 158897469) has the molecular formula C51H31N3O2 and a molecular weight of 717.83 g/mol. Its IUPAC name is 4-[1-(4-isocyanophenyl)carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[1-(4-isocyanophenyl)carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158897469 |
| Molecular Formula | C51H31N3O2 |
| Molecular Weight | 717.83 g/mol |
| Exact Mass | 717.24 |
| IUPAC Name | 4-[1-(4-isocyanophenyl)carbazol-9-yl]-2-(2,4,6-triphenylphenyl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c4ccccc4n(-c4cccc5c4C(=O)N(c4c(-c6ccccc6)cc(-c6ccccc6)cc4-c4ccccc4)C5=O)c23)cc1 |
| InChI | InChI=1S/C51H31N3O2/c1-52-38-29-27-36(28-30-38)39-22-13-23-41-40-21-11-12-25-45(40)53(48(39)41)46-26-14-24-42-47(46)51(56)54(50(42)55)49-43(34-17-7-3-8-18-34)31-37(33-15-5-2-6-16-33)32-44(49)35-19-9-4-10-20-35/h2-32H |
| InChIKey | HVRVAJZZVJSXQS-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.83 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|