C58H34N4O2 — CID 134234940
2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-triphenylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile (PubChem CID 134234940) has the molecular formula C58H34N4O2 and a molecular weight of 818.94 g/mol. Its IUPAC name is 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-triphenylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile.
| Compound Name | 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-triphenylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 134234940 |
| Molecular Formula | C58H34N4O2 |
| Molecular Weight | 818.94 g/mol |
| Exact Mass | 818.27 |
| IUPAC Name | 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-triphenylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1cccc2c3cccc(-c4ccccc4C#N)c3n(-c3cccc4c3C(=O)N(c3c(-c5ccccc5)cc(-c5ccccc5)cc3-c3ccccc3)C4=O)c12 |
| InChI | InChI=1S/C58H34N4O2/c59-35-40-23-10-12-25-43(40)45-27-14-29-47-48-30-15-28-46(44-26-13-11-24-41(44)36-60)55(48)61(54(45)47)52-32-16-31-49-53(52)58(64)62(57(49)63)56-50(38-19-6-2-7-20-38)33-42(37-17-4-1-5-18-37)34-51(56)39-21-8-3-9-22-39/h1-34H |
| InChIKey | GYTMNKCZTWXDOC-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.94 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|