C43H28N4O2 — CID 166776610
2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile (PubChem CID 166776610) has the molecular formula C43H28N4O2 and a molecular weight of 632.72 g/mol. Its IUPAC name is 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile.
| Compound Name | 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 166776610 |
| Molecular Formula | C43H28N4O2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2-[8-(2-cyanophenyl)-9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazol-1-yl]benzonitrile |
| SMILES | Cc1cc(C)c(N2C(=O)c3cccc(-n4c5c(-c6ccccc6C#N)cccc5c5cccc(-c6ccccc6C#N)c54)c3C2=O)c(C)c1 |
| InChI | InChI=1S/C43H28N4O2/c1-25-21-26(2)39(27(3)22-25)47-42(48)36-19-10-20-37(38(36)43(47)49)46-40-32(30-13-6-4-11-28(30)23-44)15-8-17-34(40)35-18-9-16-33(41(35)46)31-14-7-5-12-29(31)24-45/h4-22H,1-3H3 |
| InChIKey | FFNOKSLHEKTRKR-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|