C42H26N4O2 — CID 162173644
4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)-8-(4-isocyano-2-methylphenyl)carbazol-1-yl]-3-methylbenzonitrile (PubChem CID 162173644) has the molecular formula C42H26N4O2 and a molecular weight of 618.70 g/mol. Its IUPAC name is 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)-8-(4-isocyano-2-methylphenyl)carbazol-1-yl]-3-methylbenzonitrile.
| Compound Name | 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)-8-(4-isocyano-2-methylphenyl)carbazol-1-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 162173644 |
| Molecular Formula | C42H26N4O2 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)-8-(4-isocyano-2-methylphenyl)carbazol-1-yl]-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c4cccc(-c5ccc(C#N)cc5C)c4n(-c4cccc5c4C(=O)N(c4ccccc4)C5=O)c23)c(C)c1 |
| InChI | InChI=1S/C42H26N4O2/c1-25-22-27(24-43)18-20-30(25)32-12-7-14-34-35-15-8-13-33(31-21-19-28(44-3)23-26(31)2)40(35)46(39(32)34)37-17-9-16-36-38(37)42(48)45(41(36)47)29-10-5-4-6-11-29/h4-23H,1-2H3 |
| InChIKey | HFCLWHPLJOYMIF-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|