C34H21N3O2 — CID 146734854
4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)carbazol-3-yl]-3-methylbenzonitrile (PubChem CID 146734854) has the molecular formula C34H21N3O2 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)carbazol-3-yl]-3-methylbenzonitrile.
| Compound Name | 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)carbazol-3-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 146734854 |
| Molecular Formula | C34H21N3O2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[9-(1,3-dioxo-2-phenylisoindol-4-yl)carbazol-3-yl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccc2c(c1)c1ccccc1n2-c1cccc2c1C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C34H21N3O2/c1-21-18-22(20-35)14-16-25(21)23-15-17-30-28(19-23)26-10-5-6-12-29(26)37(30)31-13-7-11-27-32(31)34(39)36(33(27)38)24-8-3-2-4-9-24/h2-19H,1H3 |
| InChIKey | RIYVBHMTKDFRAQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|