C66H41N7O4 — CID 134239927
2,4-bis[6-(4-cyano-2-methylphenyl)-9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-3-yl]-5-methylbenzonitrile (PubChem CID 134239927) has the molecular formula C66H41N7O4 and a molecular weight of 996.10 g/mol. Its IUPAC name is 2,4-bis[6-(4-cyano-2-methylphenyl)-9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-3-yl]-5-methylbenzonitrile.
| Compound Name | 2,4-bis[6-(4-cyano-2-methylphenyl)-9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-3-yl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 134239927 |
| Molecular Formula | C66H41N7O4 |
| Molecular Weight | 996.10 g/mol |
| Exact Mass | 995.32 |
| IUPAC Name | 2,4-bis[6-(4-cyano-2-methylphenyl)-9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-3-yl]-5-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccc2c(c1)c1cc(-c3cc(-c4ccc5c(c4)c4cc(-c6ccc(C#N)cc6C)ccc4n5-c4cccc5c4C(=O)N(C)C5=O)c(C#N)cc3C)ccc1n2-c1cccc2c1C(=O)N(C)C2=O |
| InChI | InChI=1S/C66H41N7O4/c1-35-24-38(32-67)12-18-45(35)40-14-20-55-51(27-40)53-29-42(16-22-57(53)72(55)59-10-6-8-47-61(59)65(76)70(4)63(47)74)49-31-50(44(34-69)26-37(49)3)43-17-23-58-54(30-43)52-28-41(46-19-13-39(33-68)25-36(46)2)15-21-56(52)73(58)60-11-7-9-48-62(60)66(77)71(5)64(48)75/h6-31H,1-5H3 |
| InChIKey | DQJMGMCYZYHJGS-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 155.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.10 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|