C31H25N3O2 — CID 142280577
ethane;3-methyl-4-[9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-2-yl]benzonitrile (PubChem CID 142280577) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is ethane;3-methyl-4-[9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-2-yl]benzonitrile.
| Compound Name | ethane;3-methyl-4-[9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 142280577 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | ethane;3-methyl-4-[9-(2-methyl-1,3-dioxoisoindol-4-yl)carbazol-2-yl]benzonitrile |
| SMILES | CC.Cc1cc(C#N)ccc1-c1ccc2c3ccccc3n(-c3cccc4c3C(=O)N(C)C4=O)c2c1 |
| InChI | InChI=1S/C29H19N3O2.C2H6/c1-17-14-18(16-30)10-12-20(17)19-11-13-22-21-6-3-4-8-24(21)32(26(22)15-19)25-9-5-7-23-27(25)29(34)31(2)28(23)33;1-2/h3-15H,1-2H3;1-2H3 |
| InChIKey | UDOPPROHYZFNDJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|