C38H28N4O2 — CID 142280463
2-[3,6-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-6-formyl-N,N-dimethylbenzamide (PubChem CID 142280463) has the molecular formula C38H28N4O2 and a molecular weight of 572.67 g/mol. Its IUPAC name is 2-[3,6-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-6-formyl-N,N-dimethylbenzamide.
| Compound Name | 2-[3,6-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-6-formyl-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142280463 |
| Molecular Formula | C38H28N4O2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 2-[3,6-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-6-formyl-N,N-dimethylbenzamide |
| SMILES | Cc1cc(C#N)ccc1-c1ccc2c(c1)c1cc(-c3ccc(C#N)cc3C)ccc1n2-c1cccc(C=O)c1C(=O)N(C)C |
| InChI | InChI=1S/C38H28N4O2/c1-23-16-25(20-39)8-12-30(23)27-10-14-34-32(18-27)33-19-28(31-13-9-26(21-40)17-24(31)2)11-15-35(33)42(34)36-7-5-6-29(22-43)37(36)38(44)41(3)4/h5-19,22H,1-4H3 |
| InChIKey | YKGHHNRMHTYGCX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|