C55H44N2O2 — CID 142280782
2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide (PubChem CID 142280782) has the molecular formula C55H44N2O2 and a molecular weight of 764.97 g/mol. Its IUPAC name is 2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide.
| Compound Name | 2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 142280782 |
| Molecular Formula | C55H44N2O2 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.34 |
| IUPAC Name | 2-[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)cc4C)ccc2n3-c2cccc(C=O)c2C(=O)N(C)c2ccc(-c3ccccc3)cc2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C55H44N2O2/c1-35-19-24-45(37(3)29-35)42-22-27-51-48(32-42)49-33-43(46-25-20-36(2)30-38(46)4)23-28-52(49)57(51)53-18-12-17-44(34-58)54(53)55(59)56(5)50-26-21-41(39-13-8-6-9-14-39)31-47(50)40-15-10-7-11-16-40/h6-34H,1-5H3 |
| InChIKey | LPRVQPTXPREQBD-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|