C53H40N2O2 — CID 166989464
2-[1,8-bis(4-methylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide (PubChem CID 166989464) has the molecular formula C53H40N2O2 and a molecular weight of 736.92 g/mol. Its IUPAC name is 2-[1,8-bis(4-methylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide.
| Compound Name | 2-[1,8-bis(4-methylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 166989464 |
| Molecular Formula | C53H40N2O2 |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 736.31 |
| IUPAC Name | 2-[1,8-bis(4-methylphenyl)carbazol-9-yl]-N-(2,4-diphenylphenyl)-6-formyl-N-methylbenzamide |
| SMILES | Cc1ccc(-c2cccc3c4cccc(-c5ccc(C)cc5)c4n(-c4cccc(C=O)c4C(=O)N(C)c4ccc(-c5ccccc5)cc4-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C53H40N2O2/c1-35-23-27-39(28-24-35)43-18-11-20-45-46-21-12-19-44(40-29-25-36(2)26-30-40)52(46)55(51(43)45)49-22-10-17-42(34-56)50(49)53(57)54(3)48-32-31-41(37-13-6-4-7-14-37)33-47(48)38-15-8-5-9-16-38/h4-34H,1-3H3 |
| InChIKey | PMNMZHKNZVLCNW-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|