C46H31F3N2O2 — CID 166989510
N-formyl-2-methyl-6-[1-(trifluoromethyl)carbazol-9-yl]-N-(2,4,6-triphenylphenyl)benzamide (PubChem CID 166989510) has the molecular formula C46H31F3N2O2 and a molecular weight of 700.76 g/mol. Its IUPAC name is N-formyl-2-methyl-6-[1-(trifluoromethyl)carbazol-9-yl]-N-(2,4,6-triphenylphenyl)benzamide.
| Compound Name | N-formyl-2-methyl-6-[1-(trifluoromethyl)carbazol-9-yl]-N-(2,4,6-triphenylphenyl)benzamide |
|---|---|
| PubChem CID | 166989510 |
| Molecular Formula | C46H31F3N2O2 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | N-formyl-2-methyl-6-[1-(trifluoromethyl)carbazol-9-yl]-N-(2,4,6-triphenylphenyl)benzamide |
| SMILES | Cc1cccc(-n2c3ccccc3c3cccc(C(F)(F)F)c32)c1C(=O)N(C=O)c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C46H31F3N2O2/c1-30-15-13-26-41(51-40-25-12-11-22-35(40)36-23-14-24-39(44(36)51)46(47,48)49)42(30)45(53)50(29-52)43-37(32-18-7-3-8-19-32)27-34(31-16-5-2-6-17-31)28-38(43)33-20-9-4-10-21-33/h2-29H,1H3 |
| InChIKey | FCXXHRZIXIWXOU-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|