C33H19F3N2O2 — CID 134233924
2-(2-phenylphenyl)-4-[1-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione (PubChem CID 134233924) has the molecular formula C33H19F3N2O2 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-(2-phenylphenyl)-4-[1-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione.
| Compound Name | 2-(2-phenylphenyl)-4-[1-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134233924 |
| Molecular Formula | C33H19F3N2O2 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-(2-phenylphenyl)-4-[1-(trifluoromethyl)carbazol-9-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4ccccc4c4cccc(C(F)(F)F)c43)c2C(=O)N1c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C33H19F3N2O2/c34-33(35,36)25-16-8-14-23-22-13-5-7-18-27(22)37(30(23)25)28-19-9-15-24-29(28)32(40)38(31(24)39)26-17-6-4-12-21(26)20-10-2-1-3-11-20/h1-19H |
| InChIKey | JBTKAYAXTMXUKQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|