C55H32N6O2 — CID 142280856
2-[2,7-bis(3,5-dicyanophenyl)carbazol-9-yl]-N-(3,5-diphenylphenyl)-N-formyl-6-methylbenzamide (PubChem CID 142280856) has the molecular formula C55H32N6O2 and a molecular weight of 808.90 g/mol. Its IUPAC name is 2-[2,7-bis(3,5-dicyanophenyl)carbazol-9-yl]-N-(3,5-diphenylphenyl)-N-formyl-6-methylbenzamide.
| Compound Name | 2-[2,7-bis(3,5-dicyanophenyl)carbazol-9-yl]-N-(3,5-diphenylphenyl)-N-formyl-6-methylbenzamide |
|---|---|
| PubChem CID | 142280856 |
| Molecular Formula | C55H32N6O2 |
| Molecular Weight | 808.90 g/mol |
| Exact Mass | 808.26 |
| IUPAC Name | 2-[2,7-bis(3,5-dicyanophenyl)carbazol-9-yl]-N-(3,5-diphenylphenyl)-N-formyl-6-methylbenzamide |
| SMILES | Cc1cccc(-n2c3cc(-c4cc(C#N)cc(C#N)c4)ccc3c3ccc(-c4cc(C#N)cc(C#N)c4)cc32)c1C(=O)N(C=O)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C55H32N6O2/c1-35-9-8-14-51(54(35)55(63)60(34-62)48-26-46(40-10-4-2-5-11-40)25-47(27-48)41-12-6-3-7-13-41)61-52-28-42(44-21-36(30-56)19-37(22-44)31-57)15-17-49(52)50-18-16-43(29-53(50)61)45-23-38(32-58)20-39(24-45)33-59/h2-29,34H,1H3 |
| InChIKey | YXLGIHCLDBNHJO-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 137.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.90 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|