C46H36N4O2 — CID 142280582
2-[4,5-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 142280582) has the molecular formula C46H36N4O2 and a molecular weight of 676.82 g/mol. Its IUPAC name is 2-[4,5-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 2-[4,5-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 142280582 |
| Molecular Formula | C46H36N4O2 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 2-[4,5-bis(4-cyano-2-methylphenyl)carbazol-9-yl]-N-formyl-6-methyl-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c(N(C=O)C(=O)c2c(C)cccc2-n2c3cccc(-c4ccc(C#N)cc4C)c3c3c(-c4ccc(C#N)cc4C)cccc32)c(C)c1 |
| InChI | InChI=1S/C46H36N4O2/c1-27-20-31(5)45(32(6)21-27)49(26-51)46(52)42-28(2)10-7-13-39(42)50-40-14-8-11-37(35-18-16-33(24-47)22-29(35)3)43(40)44-38(12-9-15-41(44)50)36-19-17-34(25-48)23-30(36)4/h7-23,26H,1-6H3 |
| InChIKey | ZPLNMYKBZSPOTP-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|