C31H20N4O2 — CID 134239887
9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile (PubChem CID 134239887) has the molecular formula C31H20N4O2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile.
| Compound Name | 9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 134239887 |
| Molecular Formula | C31H20N4O2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 9-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]carbazole-4,5-dicarbonitrile |
| SMILES | Cc1cc(C)c(N2C(=O)c3cccc(-n4c5cccc(C#N)c5c5c(C#N)cccc54)c3C2=O)c(C)c1 |
| InChI | InChI=1S/C31H20N4O2/c1-17-13-18(2)29(19(3)14-17)35-30(36)22-9-6-12-25(28(22)31(35)37)34-23-10-4-7-20(15-32)26(23)27-21(16-33)8-5-11-24(27)34/h4-14H,1-3H3 |
| InChIKey | UJONUEUORPBFJR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|