C52H39N3O4 — CID 130437644
4-[6-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]-9-phenylcarbazol-3-yl]-2-(2,4,6-trimethylphenyl)isoindole-1,3-dione (PubChem CID 130437644) has the molecular formula C52H39N3O4 and a molecular weight of 769.90 g/mol. Its IUPAC name is 4-[6-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]-9-phenylcarbazol-3-yl]-2-(2,4,6-trimethylphenyl)isoindole-1,3-dione.
| Compound Name | 4-[6-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]-9-phenylcarbazol-3-yl]-2-(2,4,6-trimethylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 130437644 |
| Molecular Formula | C52H39N3O4 |
| Molecular Weight | 769.90 g/mol |
| Exact Mass | 769.29 |
| IUPAC Name | 4-[6-[1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindol-4-yl]-9-phenylcarbazol-3-yl]-2-(2,4,6-trimethylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cc(C)c(N2C(=O)c3cccc(-c4ccc5c(c4)c4cc(-c6cccc7c6C(=O)N(c6c(C)cc(C)cc6C)C7=O)ccc4n5-c4ccccc4)c3C2=O)c(C)c1 |
| InChI | InChI=1S/C52H39N3O4/c1-28-22-30(3)47(31(4)23-28)54-49(56)39-16-10-14-37(45(39)51(54)58)34-18-20-43-41(26-34)42-27-35(19-21-44(42)53(43)36-12-8-7-9-13-36)38-15-11-17-40-46(38)52(59)55(50(40)57)48-32(5)24-29(2)25-33(48)6/h7-27H,1-6H3 |
| InChIKey | FNJNLGBJVBAOMC-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.90 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|